C22H16F7N3O3 — CID 42602917
3-(5-fluoro-2-pyridinyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide (PubChem CID 42602917) has the molecular formula C22H16F7N3O3 and a molecular weight of 503.37 g/mol. Its IUPAC name is 3-(5-fluoro-2-pyridinyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide.
| Compound Name | 3-(5-fluoro-2-pyridinyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 42602917 |
| Molecular Formula | C22H16F7N3O3 |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 3-(5-fluoro-2-pyridinyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1cc(-c2ccc(F)cn2)cc(C(O)C(F)(F)F)c1)c1ccc(C(F)(F)F)[n+]([O-])c1 |
| InChI | InChI=1S/C22H16F7N3O3/c1-11(12-2-5-18(21(24,25)26)32(35)10-12)31-20(34)15-7-13(17-4-3-16(23)9-30-17)6-14(8-15)19(33)22(27,28)29/h2-11,19,33H,1H3,(H,31,34)/t11-,19?/m1/s1 |
| InChIKey | XQMUMMJCEJXGIO-AMIJKRQISA-N |
| XLogP | 4.63 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|