C24H18F9N3O2 — CID 42603037
3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(4-methylphenyl)-N-[(1R)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide (PubChem CID 42603037) has the molecular formula C24H18F9N3O2 and a molecular weight of 551.41 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(4-methylphenyl)-N-[(1R)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(4-methylphenyl)-N-[(1R)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42603037 |
| Molecular Formula | C24H18F9N3O2 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(4-methylphenyl)-N-[(1R)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N[C@H](C)c3cnc(C(F)(F)F)nc3)cc(C(O)(C(F)(F)F)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H18F9N3O2/c1-12-3-5-14(6-4-12)15-7-16(9-18(8-15)21(38,23(28,29)30)24(31,32)33)19(37)36-13(2)17-10-34-20(35-11-17)22(25,26)27/h3-11,13,38H,1-2H3,(H,36,37)/t13-/m1/s1 |
| InChIKey | FSUJWILWVBWPJZ-CYBMUJFWSA-N |
| XLogP | 6.27 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |