C32H33FN4O3 — CID 42603470
4-(2-fluorophenyl)-2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 42603470) has the molecular formula C32H33FN4O3 and a molecular weight of 540.64 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 4-(2-fluorophenyl)-2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 42603470 |
| Molecular Formula | C32H33FN4O3 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-(2-fluorophenyl)-2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | COc1ccc2[nH]cc(C3CCN(CCCCn4c(=O)c(-c5ccccc5F)c5ccccn5c4=O)CC3)c2c1 |
| InChI | InChI=1S/C32H33FN4O3/c1-40-23-11-12-28-25(20-23)26(21-34-28)22-13-18-35(19-14-22)15-6-7-17-37-31(38)30(24-8-2-3-9-27(24)33)29-10-4-5-16-36(29)32(37)39/h2-5,8-12,16,20-22,34H,6-7,13-15,17-19H2,1H3 |
| InChIKey | PJMAERFITHRPSK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|