C32H34N4O2 — CID 42603619
2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-(4-methylphenyl)pyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 42603619) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-(4-methylphenyl)pyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-(4-methylphenyl)pyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 42603619 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-(4-methylphenyl)pyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | Cc1ccc(-c2c(=O)n(CCCCN3CCC(c4c[nH]c5ccccc45)CC3)c(=O)n3ccccc23)cc1 |
| InChI | InChI=1S/C32H34N4O2/c1-23-11-13-25(14-12-23)30-29-10-4-5-18-35(29)32(38)36(31(30)37)19-7-6-17-34-20-15-24(16-21-34)27-22-33-28-9-3-2-8-26(27)28/h2-5,8-14,18,22,24,33H,6-7,15-17,19-21H2,1H3 |
| InChIKey | JCKHEWUNFQDEPV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|