C23H42O4 — CID 42603925
(1R,2S,4R)-4-[(Z)-2-hydroxyheptadec-10-enyl]cyclohex-5-ene-1,2,4-triol (PubChem CID 42603925) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is (1R,2S,4R)-4-[(Z)-2-hydroxyheptadec-10-enyl]cyclohex-5-ene-1,2,4-triol.
| Compound Name | (1R,2S,4R)-4-[(Z)-2-hydroxyheptadec-10-enyl]cyclohex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 42603925 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (1R,2S,4R)-4-[(Z)-2-hydroxyheptadec-10-enyl]cyclohex-5-ene-1,2,4-triol |
| SMILES | CCCCCC/C=C\CCCCCCCC(O)C[C@]1(O)C=C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C23H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)18-23(27)17-16-21(25)22(26)19-23/h7-8,16-17,20-22,24-27H,2-6,9-15,18-19H2,1H3/b8-7-/t20?,21-,22+,23-/m1/s1 |
| InChIKey | GPQHXYCUPVMFQJ-DBJIEAMRSA-N |
| XLogP | 4.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|