About 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal
3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal (PubChem CID 42604197) has the molecular formula C20H38O3Si
and a molecular weight of 354.61 g/mol. Its IUPAC name is 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal.
Molecular Properties
| Compound Name | 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal |
| PubChem CID | 42604197 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal |
| SMILES | C=C1C[C@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)O[C@H]1CCC=O |
| InChI | InChI=1S/C20H38O3Si/c1-15(2)24(16(3)4,17(5)6)22-13-9-10-19-14-18(7)20(23-19)11-8-12-21/h12,15-17,19-20H,7-11,13-14H2,1-6H3/t19-,20-/m0/s1 |
| InChIKey | AAPMAGYESNCPJW-PMACEKPBSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal?
The IUPAC name of 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal (CID 42604197) is 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal.
What is the SMILES notation for 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal?
The canonical SMILES for 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal is C=C1C[C@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)O[C@H]1CCC=O.
What is the InChIKey of 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal?
The InChIKey is AAPMAGYESNCPJW-PMACEKPBSA-N. The full InChI is InChI=1S/C20H38O3Si/c1-15(2)24(16(3)4,17(5)6)22-13-9-10-19-14-18(7)20(23-19)11-8-12-21/h12,15-17,19-20H,7-11,13-14H2,1-6H3/t19-,20-/m0/s1.
What are the key properties of 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal?
3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal has a molecular weight of 354.61 g/mol, XLogP of 5.65, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,5S)-3-methylidene-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-2-yl]propanal is sourced from PubChem (CID 42604197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).