About CID 42604299
CID 42604299 (PubChem CID 42604299) has the molecular formula C26H20FeN2O+2
and a molecular weight of 432.30 g/mol.
Molecular Properties
| Compound Name | CID 42604299 |
| PubChem CID | 42604299 |
| Molecular Formula | C26H20FeN2O+2 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | — |
| SMILES | O=Cc1cn(-c2ccccc2)nc1-c1ccccc1[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C21H15N2O.C5H5.Fe/c24-15-17-14-23(18-10-2-1-3-11-18)22-21(17)20-13-7-6-12-19(20)16-8-4-5-9-16;1-2-4-5-3-1;/h1-15H;1-5H;/q;;+2 |
| InChIKey | DBRLLHRRBQCBPE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 42604299 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 42604299?
The IUPAC name of CID 42604299 (CID 42604299) is not available.
What is the SMILES notation for CID 42604299?
The canonical SMILES for CID 42604299 is O=Cc1cn(-c2ccccc2)nc1-c1ccccc1[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 42604299?
The InChIKey is DBRLLHRRBQCBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N2O.C5H5.Fe/c24-15-17-14-23(18-10-2-1-3-11-18)22-21(17)20-13-7-6-12-19(20)16-8-4-5-9-16;1-2-4-5-3-1;/h1-15H;1-5H;/q;;+2.
What are the key properties of CID 42604299?
CID 42604299 has a molecular weight of 432.30 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 42604299 is sourced from PubChem (CID 42604299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).