C30H30N2O2 — CID 42604404
benzyl (3aR,6aS,11bS)-7-benzyl-5-methylidene-1,2,3a,4,6,6a-hexahydropyrrolo[2,3-d]carbazole-3-carboxylate (PubChem CID 42604404) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is benzyl (3aR,6aS,11bS)-7-benzyl-5-methylidene-1,2,3a,4,6,6a-hexahydropyrrolo[2,3-d]carbazole-3-carboxylate.
| Compound Name | benzyl (3aR,6aS,11bS)-7-benzyl-5-methylidene-1,2,3a,4,6,6a-hexahydropyrrolo[2,3-d]carbazole-3-carboxylate |
|---|---|
| PubChem CID | 42604404 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | benzyl (3aR,6aS,11bS)-7-benzyl-5-methylidene-1,2,3a,4,6,6a-hexahydropyrrolo[2,3-d]carbazole-3-carboxylate |
| SMILES | C=C1C[C@@H]2N(Cc3ccccc3)c3ccccc3[C@@]23CCN(C(=O)OCc2ccccc2)[C@@H]3C1 |
| InChI | InChI=1S/C30H30N2O2/c1-22-18-27-30(16-17-31(27)29(33)34-21-24-12-6-3-7-13-24)25-14-8-9-15-26(25)32(28(30)19-22)20-23-10-4-2-5-11-23/h2-15,27-28H,1,16-21H2/t27-,28+,30-/m1/s1 |
| InChIKey | JUWKOJYCLSXIOS-OYKXOOMRSA-N |
| XLogP | 6.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|