C14H9FN2Se — CID 42604461
2-(4-fluorophenyl)-5-phenyl-1,3,4-selenadiazole (PubChem CID 42604461) has the molecular formula C14H9FN2Se and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-phenyl-1,3,4-selenadiazole.
| Compound Name | 2-(4-fluorophenyl)-5-phenyl-1,3,4-selenadiazole |
|---|---|
| PubChem CID | 42604461 |
| Molecular Formula | C14H9FN2Se |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-(4-fluorophenyl)-5-phenyl-1,3,4-selenadiazole |
| SMILES | Fc1ccc(-c2nnc(-c3ccccc3)[se]2)cc1 |
| InChI | InChI=1S/C14H9FN2Se/c15-12-8-6-11(7-9-12)14-17-16-13(18-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | RHYWLFLKFVXLHK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|