C15H29NO4SSi — CID 42604601
3-[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]butanoyl]-1,3-oxazolidin-2-one (PubChem CID 42604601) has the molecular formula C15H29NO4SSi and a molecular weight of 347.55 g/mol. Its IUPAC name is 3-[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 42604601 |
| Molecular Formula | C15H29NO4SSi |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CC(=O)N1CCOC1=O)SCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO4SSi/c1-12(11-13(17)16-7-8-19-14(16)18)21-10-9-20-22(5,6)15(2,3)4/h12H,7-11H2,1-6H3/t12-/m1/s1 |
| InChIKey | XHJFTFUPJHYUDF-GFCCVEGCSA-N |
| XLogP | 3.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|