C31H51NO3S2Si — CID 42604606
(E,3R,4R,5R,6S)-5-methoxy-4,6-dimethyl-1-[(4S)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-thiazolidin-3-yl]-3-triethylsilyloxydec-8-en-1-one (PubChem CID 42604606) has the molecular formula C31H51NO3S2Si and a molecular weight of 577.97 g/mol. Its IUPAC name is (E,3R,4R,5R,6S)-5-methoxy-4,6-dimethyl-1-[(4S)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-thiazolidin-3-yl]-3-triethylsilyloxydec-8-en-1-one.
| Compound Name | (E,3R,4R,5R,6S)-5-methoxy-4,6-dimethyl-1-[(4S)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-thiazolidin-3-yl]-3-triethylsilyloxydec-8-en-1-one |
|---|---|
| PubChem CID | 42604606 |
| Molecular Formula | C31H51NO3S2Si |
| Molecular Weight | 577.97 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | (E,3R,4R,5R,6S)-5-methoxy-4,6-dimethyl-1-[(4S)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-thiazolidin-3-yl]-3-triethylsilyloxydec-8-en-1-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](CC(=O)N1C(=S)SC[C@@H]1c1c(C)cc(C)cc1C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H51NO3S2Si/c1-11-15-16-22(6)30(34-10)25(9)27(35-38(12-2,13-3)14-4)19-28(33)32-26(20-37-31(32)36)29-23(7)17-21(5)18-24(29)8/h11,15,17-18,22,25-27,30H,12-14,16,19-20H2,1-10H3/b15-11+/t22-,25-,26+,27+,30+/m0/s1 |
| InChIKey | GFVJQANGDKOYKC-RAIQGTIVSA-N |
| XLogP | 8.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.97 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|