C41H66O4Si2 — CID 42604725
tert-butyl-[(E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoxy]-diphenylsilane (PubChem CID 42604725) has the molecular formula C41H66O4Si2 and a molecular weight of 679.15 g/mol. Its IUPAC name is tert-butyl-[(E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 42604725 |
| Molecular Formula | C41H66O4Si2 |
| Molecular Weight | 679.15 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | tert-butyl-[(E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoxy]-diphenylsilane |
| SMILES | C=C(C[C@@H](COC1CCCCO1)O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H66O4Si2/c1-32(27-33(2)30-44-47(41(8,9)10,37-21-15-13-16-22-37)38-23-17-14-18-24-38)28-34(3)35(4)29-36(45-46(11,12)40(5,6)7)31-43-39-25-19-20-26-42-39/h13-18,21-24,28,32-33,36,39H,4,19-20,25-27,29-31H2,1-3,5-12H3/b34-28+/t32-,33-,36+,39?/m1/s1 |
| InChIKey | IIRCLPNVXRCJQY-IJYQXOIYSA-N |
| XLogP | 10.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.15 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|