C18H17N3O2 — CID 42604831
(3aS,10aR)-4-hydroxy-10-(pyridin-4-ylmethyl)-3a,10a-dihydro-3H-cyclopenta[b][1,4]benzodiazepin-5-one (PubChem CID 42604831) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3aS,10aR)-4-hydroxy-10-(pyridin-4-ylmethyl)-3a,10a-dihydro-3H-cyclopenta[b][1,4]benzodiazepin-5-one.
| Compound Name | (3aS,10aR)-4-hydroxy-10-(pyridin-4-ylmethyl)-3a,10a-dihydro-3H-cyclopenta[b][1,4]benzodiazepin-5-one |
|---|---|
| PubChem CID | 42604831 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (3aS,10aR)-4-hydroxy-10-(pyridin-4-ylmethyl)-3a,10a-dihydro-3H-cyclopenta[b][1,4]benzodiazepin-5-one |
| SMILES | O=C1c2ccccc2N(Cc2ccncc2)[C@@H]2C=CC[C@@H]2N1O |
| InChI | InChI=1S/C18H17N3O2/c22-18-14-4-1-2-5-15(14)20(12-13-8-10-19-11-9-13)16-6-3-7-17(16)21(18)23/h1-6,8-11,16-17,23H,7,12H2/t16-,17+/m1/s1 |
| InChIKey | MPAXGYKMOSGAME-SJORKVTESA-N |
| XLogP | 2.63 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|