C23H36O5 — CID 42604982
5,6-dimethoxy-5,6-dimethyl-3-pentadeca-8,10-diynyl-1,4-dioxan-2-one (PubChem CID 42604982) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 5,6-dimethoxy-5,6-dimethyl-3-pentadeca-8,10-diynyl-1,4-dioxan-2-one.
| Compound Name | 5,6-dimethoxy-5,6-dimethyl-3-pentadeca-8,10-diynyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 42604982 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 5,6-dimethoxy-5,6-dimethyl-3-pentadeca-8,10-diynyl-1,4-dioxan-2-one |
| SMILES | CCCCC#CC#CCCCCCCCC1OC(C)(OC)C(C)(OC)OC1=O |
| InChI | InChI=1S/C23H36O5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(24)28-23(3,26-5)22(2,25-4)27-20/h20H,6-8,13-19H2,1-5H3 |
| InChIKey | LATMNCCNTZVMSR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|