C11H22O2 — CID 42605051
(E,3R,4R,5R)-2,4,6-trimethyloct-6-ene-3,5-diol (PubChem CID 42605051) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (E,3R,4R,5R)-2,4,6-trimethyloct-6-ene-3,5-diol.
| Compound Name | (E,3R,4R,5R)-2,4,6-trimethyloct-6-ene-3,5-diol |
|---|---|
| PubChem CID | 42605051 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (E,3R,4R,5R)-2,4,6-trimethyloct-6-ene-3,5-diol |
| SMILES | C/C=C(\C)[C@H](O)[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-6-8(4)11(13)9(5)10(12)7(2)3/h6-7,9-13H,1-5H3/b8-6+/t9-,10-,11+/m1/s1 |
| InChIKey | RBOXPRAUSNOGIX-ISSQGJDESA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|