C14H23NO — CID 42605085
(8aS)-5-hexyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one (PubChem CID 42605085) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (8aS)-5-hexyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one.
| Compound Name | (8aS)-5-hexyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 42605085 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (8aS)-5-hexyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
| SMILES | CCCCCCC1=CC(=O)C[C@@H]2CCCN12 |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-5-7-12-10-14(16)11-13-8-6-9-15(12)13/h10,13H,2-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | UHDFYKPXNHBJTL-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|