C17H18N2OS — CID 42605674
9-[3-(dimethylamino)prop-1-ynyl]-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one (PubChem CID 42605674) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 9-[3-(dimethylamino)prop-1-ynyl]-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one.
| Compound Name | 9-[3-(dimethylamino)prop-1-ynyl]-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
|---|---|
| PubChem CID | 42605674 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 9-[3-(dimethylamino)prop-1-ynyl]-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
| SMILES | CN(C)CC#Cc1ccc2[nH]c(=O)c3c(c2c1)CCSC3 |
| InChI | InChI=1S/C17H18N2OS/c1-19(2)8-3-4-12-5-6-16-14(10-12)13-7-9-21-11-15(13)17(20)18-16/h5-6,10H,7-9,11H2,1-2H3,(H,18,20) |
| InChIKey | LTBUKWKRBZHOKJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|