C15H11Cl2N5O2S — CID 42605984
1-[(3,4-dichlorophenyl)methyl]-N-(5-formyl-1,3-thiazol-2-yl)-5-methyltriazole-4-carboxamide (PubChem CID 42605984) has the molecular formula C15H11Cl2N5O2S and a molecular weight of 396.26 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-(5-formyl-1,3-thiazol-2-yl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-(5-formyl-1,3-thiazol-2-yl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 42605984 |
| Molecular Formula | C15H11Cl2N5O2S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-(5-formyl-1,3-thiazol-2-yl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ncc(C=O)s2)nnn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N5O2S/c1-8-13(14(24)19-15-18-5-10(7-23)25-15)20-21-22(8)6-9-2-3-11(16)12(17)4-9/h2-5,7H,6H2,1H3,(H,18,19,24) |
| InChIKey | UXTIQTWACPISAD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|