C23H23O13+ — CID 42606047
1-[5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-6-yl]ethanone (PubChem CID 42606047) has the molecular formula C23H23O13+ and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-[5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-6-yl]ethanone.
| Compound Name | 1-[5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-6-yl]ethanone |
|---|---|
| PubChem CID | 42606047 |
| Molecular Formula | C23H23O13+ |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-[5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-6-yl]ethanone |
| SMILES | CC(=O)c1c(O)cc2[o+]c(-c3cc(O)c(O)c(O)c3)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2c1O |
| InChI | InChI=1S/C23H22O13/c1-7(25)16-10(26)5-13-9(17(16)29)4-14(22(34-13)8-2-11(27)18(30)12(28)3-8)35-23-21(33)20(32)19(31)15(6-24)36-23/h2-5,15,19-21,23-24,31-33H,6H2,1H3,(H4-,25,26,27,28,29,30)/p+1/t15-,19-,20+,21-,23-/m1/s1 |
| InChIKey | QOWCGCRVXQSLSI-CCHFTJHQSA-O |
| XLogP | 0.29 |
| TPSA | 228.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|