About 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole
3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole (PubChem CID 42606083) has the molecular formula C17H8F6N2
and a molecular weight of 354.25 g/mol. Its IUPAC name is 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole.
Molecular Properties
| Compound Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole |
| PubChem CID | 42606083 |
| Molecular Formula | C17H8F6N2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole |
| SMILES | FC(F)(F)c1cc(C#Cc2[nH]nc3ccccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H8F6N2/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)5-6-15-13-3-1-2-4-14(13)24-25-15/h1-4,7-9H,(H,24,25) |
| InChIKey | PBTMDZSKRVIXLW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole?
The IUPAC name of 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole (CID 42606083) is 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole.
What is the SMILES notation for 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole?
The canonical SMILES for 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole is FC(F)(F)c1cc(C#Cc2[nH]nc3ccccc23)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole?
The InChIKey is PBTMDZSKRVIXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8F6N2/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)5-6-15-13-3-1-2-4-14(13)24-25-15/h1-4,7-9H,(H,24,25).
What are the key properties of 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole?
3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole has a molecular weight of 354.25 g/mol, XLogP of 5.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole is sourced from PubChem (CID 42606083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).