C17H8F6N2 — CID 42606083
3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole (PubChem CID 42606083) has the molecular formula C17H8F6N2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole.
| Compound Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole |
|---|---|
| PubChem CID | 42606083 |
| Molecular Formula | C17H8F6N2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethynyl]-2H-indazole |
| SMILES | FC(F)(F)c1cc(C#Cc2[nH]nc3ccccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H8F6N2/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)5-6-15-13-3-1-2-4-14(13)24-25-15/h1-4,7-9H,(H,24,25) |
| InChIKey | PBTMDZSKRVIXLW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|