C13H9F4IN2O2 — CID 42606277
1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-iodo-6-methylpyrimidine-2,4-dione (PubChem CID 42606277) has the molecular formula C13H9F4IN2O2 and a molecular weight of 428.12 g/mol. Its IUPAC name is 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-iodo-6-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-iodo-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 42606277 |
| Molecular Formula | C13H9F4IN2O2 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-iodo-6-methylpyrimidine-2,4-dione |
| SMILES | Cc1c(I)c(=O)[nH]c(=O)n1Cc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C13H9F4IN2O2/c1-6-10(18)11(21)19-12(22)20(6)5-7-8(13(15,16)17)3-2-4-9(7)14/h2-4H,5H2,1H3,(H,19,21,22) |
| InChIKey | TZBUKGISILNJCR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|