C21H33FO4 — CID 42606914
(Z)-7-[(1S,2R)-2-[(3S)-2-fluoro-3-hydroxyoctyl]-3-methylidene-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 42606914) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is (Z)-7-[(1S,2R)-2-[(3S)-2-fluoro-3-hydroxyoctyl]-3-methylidene-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R)-2-[(3S)-2-fluoro-3-hydroxyoctyl]-3-methylidene-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 42606914 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (Z)-7-[(1S,2R)-2-[(3S)-2-fluoro-3-hydroxyoctyl]-3-methylidene-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | C=C1CC(=O)[C@@H](C/C=C\CCCC(=O)O)[C@H]1CC(F)[C@@H](O)CCCCC |
| InChI | InChI=1S/C21H33FO4/c1-3-4-7-11-19(23)18(22)14-17-15(2)13-20(24)16(17)10-8-5-6-9-12-21(25)26/h5,8,16-19,23H,2-4,6-7,9-14H2,1H3,(H,25,26)/b8-5-/t16-,17-,18?,19-/m0/s1 |
| InChIKey | FZZZOBKANRNJSH-UXWKWGIGSA-N |
| XLogP | 4.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|