C17H20N2O2S — CID 42606948
9-piperidin-3-yloxy-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one (PubChem CID 42606948) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 9-piperidin-3-yloxy-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one.
| Compound Name | 9-piperidin-3-yloxy-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
|---|---|
| PubChem CID | 42606948 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 9-piperidin-3-yloxy-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
| SMILES | O=c1[nH]c2ccc(OC3CCCNC3)cc2c2c1CSCC2 |
| InChI | InChI=1S/C17H20N2O2S/c20-17-15-10-22-7-5-13(15)14-8-11(3-4-16(14)19-17)21-12-2-1-6-18-9-12/h3-4,8,12,18H,1-2,5-7,9-10H2,(H,19,20) |
| InChIKey | WLXRQZQAQHWPCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |