C22H35FO4 — CID 42607141
(Z)-7-[(1R,2R,3S)-3-fluoro-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 42607141) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S)-3-fluoro-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S)-3-fluoro-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 42607141 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3S)-3-fluoro-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@H]1[C@@H](F)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H35FO4/c1-4-5-14-22(2,3)20(25)13-12-16-17(19(24)15-18(16)23)10-8-6-7-9-11-21(26)27/h6,8,12-13,16-18,20,25H,4-5,7,9-11,14-15H2,1-3H3,(H,26,27)/b8-6-,13-12+/t16-,17-,18+,20-/m1/s1 |
| InChIKey | FRTNRRXTHBCJRK-MBNOUSKYSA-N |
| XLogP | 4.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|