C23H36O6 — CID 42607301
methyl (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 42607301) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 42607301 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C23H36O6/c1-4-5-8-11-18(29-17(2)24)14-15-20-19(21(25)16-22(20)26)12-9-6-7-10-13-23(27)28-3/h6,9,14-15,18-20,22,26H,4-5,7-8,10-13,16H2,1-3H3/b9-6-,15-14+/t18-,19-,20-,22-/m1/s1 |
| InChIKey | IDRDPQADACSXNY-ZQGVEFHQSA-N |
| XLogP | 3.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|