About 13-methylnonadecane-1,2-diol
13-methylnonadecane-1,2-diol (PubChem CID 42607320) has the molecular formula C20H42O2
and a molecular weight of 314.55 g/mol. Its IUPAC name is 13-methylnonadecane-1,2-diol.
Molecular Properties
| Compound Name | 13-methylnonadecane-1,2-diol |
| PubChem CID | 42607320 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 13-methylnonadecane-1,2-diol |
| SMILES | CCCCCCC(C)CCCCCCCCCCC(O)CO |
| InChI | InChI=1S/C20H42O2/c1-3-4-5-12-15-19(2)16-13-10-8-6-7-9-11-14-17-20(22)18-21/h19-22H,3-18H2,1-2H3 |
| InChIKey | RZTUZBQLMLKAGT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 13-methylnonadecane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-methylnonadecane-1,2-diol?
The IUPAC name of 13-methylnonadecane-1,2-diol (CID 42607320) is 13-methylnonadecane-1,2-diol.
What is the SMILES notation for 13-methylnonadecane-1,2-diol?
The canonical SMILES for 13-methylnonadecane-1,2-diol is CCCCCCC(C)CCCCCCCCCCC(O)CO.
What is the InChIKey of 13-methylnonadecane-1,2-diol?
The InChIKey is RZTUZBQLMLKAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O2/c1-3-4-5-12-15-19(2)16-13-10-8-6-7-9-11-14-17-20(22)18-21/h19-22H,3-18H2,1-2H3.
What are the key properties of 13-methylnonadecane-1,2-diol?
13-methylnonadecane-1,2-diol has a molecular weight of 314.55 g/mol, XLogP of 5.85, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13-methylnonadecane-1,2-diol is sourced from PubChem (CID 42607320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).