C30H38O4 — CID 42607731
3,5-dihydroxy-4,6,6-tris(3-methylbut-2-enyl)-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 42607731) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is 3,5-dihydroxy-4,6,6-tris(3-methylbut-2-enyl)-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-4,6,6-tris(3-methylbut-2-enyl)-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 42607731 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 3,5-dihydroxy-4,6,6-tris(3-methylbut-2-enyl)-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(C(=O)CCc2ccccc2)=C1O |
| InChI | InChI=1S/C30H38O4/c1-20(2)12-14-24-27(32)26(25(31)15-13-23-10-8-7-9-11-23)29(34)30(28(24)33,18-16-21(3)4)19-17-22(5)6/h7-12,16-17,32-33H,13-15,18-19H2,1-6H3 |
| InChIKey | LFFGARMIFWEHDF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|