C18H11N3O3 — CID 4260804
2-cyano-N-(1,3-dioxoisoindol-4-yl)-3-phenylprop-2-enamide (PubChem CID 4260804) has the molecular formula C18H11N3O3 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-cyano-N-(1,3-dioxoisoindol-4-yl)-3-phenylprop-2-enamide.
| Compound Name | 2-cyano-N-(1,3-dioxoisoindol-4-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4260804 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-cyano-N-(1,3-dioxoisoindol-4-yl)-3-phenylprop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1)C(=O)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C18H11N3O3/c19-10-12(9-11-5-2-1-3-6-11)16(22)20-14-8-4-7-13-15(14)18(24)21-17(13)23/h1-9H,(H,20,22)(H,21,23,24) |
| InChIKey | CALAYSSBWAFMLK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|