C20H20O6 — CID 42608049
(2S)-2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one (PubChem CID 42608049) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2S)-2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one.
| Compound Name | (2S)-2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 42608049 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2S)-2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
| SMILES | CC1(C)CCc2c(cc(O)c3c2O[C@H](c2ccc(O)cc2O)CC3=O)O1 |
| InChI | InChI=1S/C20H20O6/c1-20(2)6-5-12-17(26-20)9-15(24)18-14(23)8-16(25-19(12)18)11-4-3-10(21)7-13(11)22/h3-4,7,9,16,21-22,24H,5-6,8H2,1-2H3/t16-/m0/s1 |
| InChIKey | ACVUCXHKACKHFE-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |