C15H24O3 — CID 42608174
(3R,6S,8S,10S)-2,10-bis(hydroxymethyl)-6,10-dimethyltricyclo[6.3.0.03,6]undec-1-en-3-ol (PubChem CID 42608174) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R,6S,8S,10S)-2,10-bis(hydroxymethyl)-6,10-dimethyltricyclo[6.3.0.03,6]undec-1-en-3-ol.
| Compound Name | (3R,6S,8S,10S)-2,10-bis(hydroxymethyl)-6,10-dimethyltricyclo[6.3.0.03,6]undec-1-en-3-ol |
|---|---|
| PubChem CID | 42608174 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R,6S,8S,10S)-2,10-bis(hydroxymethyl)-6,10-dimethyltricyclo[6.3.0.03,6]undec-1-en-3-ol |
| SMILES | C[C@@]1(CO)CC2=C(CO)[C@@]3(O)CC[C@@]3(C)C[C@@H]2C1 |
| InChI | InChI=1S/C15H24O3/c1-13(9-17)5-10-6-14(2)3-4-15(14,18)12(8-16)11(10)7-13/h10,16-18H,3-9H2,1-2H3/t10-,13-,14-,15-/m0/s1 |
| InChIKey | AWMMKZCBBAJJAU-HJPIBITLSA-N |
| XLogP | 1.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|