C30H54 — CID 42608282
(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene (PubChem CID 42608282) has the molecular formula C30H54 and a molecular weight of 414.76 g/mol. Its IUPAC name is (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene.
| Compound Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene |
|---|---|
| PubChem CID | 42608282 |
| Molecular Formula | C30H54 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CCCC(C)C)CC/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C30H54/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h17-18,23-26H,9-16,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+ |
| InChIKey | COCRTLOZHDPILP-AAJYLUCBSA-N |
| XLogP | 10.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|