C31H50O3 — CID 42608305
(1S,6R,8R,11S,12S,13R,16R,20S)-20-(hydroxymethyl)-1,7,7,11,16,20-hexamethyl-5-methylidenepentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-ene-8,13-diol (PubChem CID 42608305) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is (1S,6R,8R,11S,12S,13R,16R,20S)-20-(hydroxymethyl)-1,7,7,11,16,20-hexamethyl-5-methylidenepentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-ene-8,13-diol.
| Compound Name | (1S,6R,8R,11S,12S,13R,16R,20S)-20-(hydroxymethyl)-1,7,7,11,16,20-hexamethyl-5-methylidenepentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-ene-8,13-diol |
|---|---|
| PubChem CID | 42608305 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (1S,6R,8R,11S,12S,13R,16R,20S)-20-(hydroxymethyl)-1,7,7,11,16,20-hexamethyl-5-methylidenepentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-ene-8,13-diol |
| SMILES | C=C1C=C2C[C@]3(C)CCC4[C@@](C)(CO)CCC[C@]4(C)C3C[C@@H](O)[C@@H]2[C@@]2(C)CC[C@@H](O)C(C)(C)[C@H]12 |
| InChI | InChI=1S/C31H50O3/c1-19-15-20-17-28(4)13-9-22-29(5,18-32)11-8-12-30(22,6)23(28)16-21(33)25(20)31(7)14-10-24(34)27(2,3)26(19)31/h15,21-26,32-34H,1,8-14,16-18H2,2-7H3/t21-,22?,23?,24-,25-,26+,28+,29-,30+,31-/m1/s1 |
| InChIKey | IBNJDPMGYWBTDV-IOSCOXFYSA-N |
| XLogP | 6.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |