C14H27NO2 — CID 42608347
(2S,3R,4E,6E)-2-aminotetradeca-4,6-diene-1,3-diol (PubChem CID 42608347) has the molecular formula C14H27NO2 and a molecular weight of 241.38 g/mol. Its IUPAC name is (2S,3R,4E,6E)-2-aminotetradeca-4,6-diene-1,3-diol.
| Compound Name | (2S,3R,4E,6E)-2-aminotetradeca-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 42608347 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2S,3R,4E,6E)-2-aminotetradeca-4,6-diene-1,3-diol |
| SMILES | CCCCCCC/C=C/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C14H27NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)13(15)12-16/h8-11,13-14,16-17H,2-7,12,15H2,1H3/b9-8+,11-10+/t13-,14+/m0/s1 |
| InChIKey | UWJZVNRNKDOZCA-LNFMSFKKSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|