About 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one
11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one (PubChem CID 42608373) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one.
Molecular Properties
| Compound Name | 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one |
| PubChem CID | 42608373 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one |
| SMILES | CCC(=O)CCCCCCCC[C@@H]1CC[C@H](O)[C@H](C)N1 |
| InChI | InChI=1S/C17H33NO2/c1-3-16(19)11-9-7-5-4-6-8-10-15-12-13-17(20)14(2)18-15/h14-15,17-18,20H,3-13H2,1-2H3/t14-,15+,17-/m0/s1 |
| InChIKey | FNYMOMSUWLCHBY-UXLLHSPISA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one?
The IUPAC name of 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one (CID 42608373) is 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one.
What is the SMILES notation for 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one?
The canonical SMILES for 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one is CCC(=O)CCCCCCCC[C@@H]1CC[C@H](O)[C@H](C)N1.
What is the InChIKey of 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one?
The InChIKey is FNYMOMSUWLCHBY-UXLLHSPISA-N. The full InChI is InChI=1S/C17H33NO2/c1-3-16(19)11-9-7-5-4-6-8-10-15-12-13-17(20)14(2)18-15/h14-15,17-18,20H,3-13H2,1-2H3/t14-,15+,17-/m0/s1.
What are the key properties of 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one?
11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one has a molecular weight of 283.46 g/mol, XLogP of 3.59, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]undecan-3-one is sourced from PubChem (CID 42608373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).