C8H11F2N — CID 42608941
5,6-difluoro-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 42608941) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 5,6-difluoro-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 5,6-difluoro-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 42608941 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 5,6-difluoro-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | FC1CC2C=CNC2CC1F |
| InChI | InChI=1S/C8H11F2N/c9-6-3-5-1-2-11-8(5)4-7(6)10/h1-2,5-8,11H,3-4H2 |
| InChIKey | SCBZKEAVLCNOIL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |