C9H15N — CID 42608947
5-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 42608947) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 5-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 5-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 42608947 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 5-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | CC1CCC2NC=CC2C1 |
| InChI | InChI=1S/C9H15N/c1-7-2-3-9-8(6-7)4-5-10-9/h4-5,7-10H,2-3,6H2,1H3 |
| InChIKey | POSKOPRQMIWHLK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |