About 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole
5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 42608985) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole.
Analyze 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole?
The IUPAC name of 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole (CID 42608985) is 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole.
What is the SMILES notation for 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole?
The canonical SMILES for 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole is CC1=CNC2CCC(F)CC12.
What is the InChIKey of 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole?
The InChIKey is UJDQRRACNSZXCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-6-5-11-9-3-2-7(10)4-8(6)9/h5,7-9,11H,2-4H2,1H3.
What are the key properties of 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole?
5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole has a molecular weight of 155.22 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-3a,4,5,6,7,7a-hexahydro-1H-indole is sourced from PubChem (CID 42608985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).