About 4-methyl-1,4-oxazepan-6-amine
4-methyl-1,4-oxazepan-6-amine (PubChem CID 42609119) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 4-methyl-1,4-oxazepan-6-amine.
Molecular Properties
| Compound Name | 4-methyl-1,4-oxazepan-6-amine |
| PubChem CID | 42609119 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 4-methyl-1,4-oxazepan-6-amine |
| SMILES | CN1CCOCC(N)C1 |
| InChI | InChI=1S/C6H14N2O/c1-8-2-3-9-5-6(7)4-8/h6H,2-5,7H2,1H3 |
| InChIKey | LHDGPYWEWPDORQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,4-oxazepan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4-oxazepan-6-amine?
The IUPAC name of 4-methyl-1,4-oxazepan-6-amine (CID 42609119) is 4-methyl-1,4-oxazepan-6-amine.
What is the SMILES notation for 4-methyl-1,4-oxazepan-6-amine?
The canonical SMILES for 4-methyl-1,4-oxazepan-6-amine is CN1CCOCC(N)C1.
What is the InChIKey of 4-methyl-1,4-oxazepan-6-amine?
The InChIKey is LHDGPYWEWPDORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-8-2-3-9-5-6(7)4-8/h6H,2-5,7H2,1H3.
What are the key properties of 4-methyl-1,4-oxazepan-6-amine?
4-methyl-1,4-oxazepan-6-amine has a molecular weight of 130.19 g/mol, XLogP of -0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4-oxazepan-6-amine is sourced from PubChem (CID 42609119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).