About 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine
8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine (PubChem CID 42609363) has the molecular formula C10H10ClN3
and a molecular weight of 207.66 g/mol. Its IUPAC name is 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine |
| PubChem CID | 42609363 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine |
| SMILES | Clc1nccn2c(C3CCC3)ncc12 |
| InChI | InChI=1S/C10H10ClN3/c11-9-8-6-13-10(7-2-1-3-7)14(8)5-4-12-9/h4-7H,1-3H2 |
| InChIKey | QKTHPZLWERNYEN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine?
The IUPAC name of 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine (CID 42609363) is 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine.
What is the SMILES notation for 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine?
The canonical SMILES for 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine is Clc1nccn2c(C3CCC3)ncc12.
What is the InChIKey of 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine?
The InChIKey is QKTHPZLWERNYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3/c11-9-8-6-13-10(7-2-1-3-7)14(8)5-4-12-9/h4-7H,1-3H2.
What are the key properties of 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine?
8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine has a molecular weight of 207.66 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine is sourced from PubChem (CID 42609363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).