C22H28O5 — CID 42609748
(3R)-3-hydroxy-1-[(2R,10E)-4-oxo-3-oxabicyclo[11.4.0]heptadeca-1(17),10,13,15-tetraen-2-yl]hexane-1,5-dione (PubChem CID 42609748) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(2R,10E)-4-oxo-3-oxabicyclo[11.4.0]heptadeca-1(17),10,13,15-tetraen-2-yl]hexane-1,5-dione.
| Compound Name | (3R)-3-hydroxy-1-[(2R,10E)-4-oxo-3-oxabicyclo[11.4.0]heptadeca-1(17),10,13,15-tetraen-2-yl]hexane-1,5-dione |
|---|---|
| PubChem CID | 42609748 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3R)-3-hydroxy-1-[(2R,10E)-4-oxo-3-oxabicyclo[11.4.0]heptadeca-1(17),10,13,15-tetraen-2-yl]hexane-1,5-dione |
| SMILES | CC(=O)C[C@@H](O)CC(=O)[C@@H]1OC(=O)CCCCC/C=C/Cc2ccccc21 |
| InChI | InChI=1S/C22H28O5/c1-16(23)14-18(24)15-20(25)22-19-12-9-8-11-17(19)10-6-4-2-3-5-7-13-21(26)27-22/h4,6,8-9,11-12,18,22,24H,2-3,5,7,10,13-15H2,1H3/b6-4+/t18-,22-/m1/s1 |
| InChIKey | WLMKUHSUSVRAIJ-MEXJDSSQSA-N |
| XLogP | 3.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|