C20H24O5 — CID 42609772
(3S)-3-hydroxy-1-[(1S,4R,6Z)-4-methyl-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione (PubChem CID 42609772) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[(1S,4R,6Z)-4-methyl-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione.
| Compound Name | (3S)-3-hydroxy-1-[(1S,4R,6Z)-4-methyl-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione |
|---|---|
| PubChem CID | 42609772 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3S)-3-hydroxy-1-[(1S,4R,6Z)-4-methyl-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione |
| SMILES | CC(=O)C[C@H](O)CC(=O)[C@H]1OC(=O)[C@H](C)C/C=C\Cc2ccccc21 |
| InChI | InChI=1S/C20H24O5/c1-13-7-3-4-8-15-9-5-6-10-17(15)19(25-20(13)24)18(23)12-16(22)11-14(2)21/h3-6,9-10,13,16,19,22H,7-8,11-12H2,1-2H3/b4-3-/t13-,16+,19+/m1/s1 |
| InChIKey | DINLKPNIMJNFMT-ICCWJEJASA-N |
| XLogP | 2.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|