C28H34N2O4 — CID 42609939
1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol (PubChem CID 42609939) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol.
| Compound Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 42609939 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol |
| SMILES | COc1ccc(CNCC(O)COc2ccc3c(c2)CCCN3Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H34N2O4/c1-32-27-13-10-22(15-28(27)33-2)17-29-18-24(31)20-34-25-11-12-26-23(16-25)9-6-14-30(26)19-21-7-4-3-5-8-21/h3-5,7-8,10-13,15-16,24,29,31H,6,9,14,17-20H2,1-2H3 |
| InChIKey | LYECPEAOXPXURS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|