About N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide
N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide (PubChem CID 42610450) has the molecular formula C23H23ClN2O3
and a molecular weight of 410.90 g/mol. Its IUPAC name is N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide |
| PubChem CID | 42610450 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)N(NC(=O)c2ccc(-c3ccccc3Cl)o2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-15-9-11-16(12-10-15)22(28)26(23(2,3)4)25-21(27)20-14-13-19(29-20)17-7-5-6-8-18(17)24/h5-14H,1-4H3,(H,25,27) |
| InChIKey | WECUIPSUACMSTN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide?
The IUPAC name of N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide (CID 42610450) is N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide.
What is the SMILES notation for N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide?
The canonical SMILES for N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide is Cc1ccc(C(=O)N(NC(=O)c2ccc(-c3ccccc3Cl)o2)C(C)(C)C)cc1.
What is the InChIKey of N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide?
The InChIKey is WECUIPSUACMSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23ClN2O3/c1-15-9-11-16(12-10-15)22(28)26(23(2,3)4)25-21(27)20-14-13-19(29-20)17-7-5-6-8-18(17)24/h5-14H,1-4H3,(H,25,27).
What are the key properties of N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide?
N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide has a molecular weight of 410.90 g/mol, XLogP of 5.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-5-(2-chlorophenyl)-N'-(4-methylbenzoyl)furan-2-carbohydrazide is sourced from PubChem (CID 42610450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).