C31H37NO7 — CID 42610648
2-[[(4R,5S,16R,18S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-22-oxo-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-18-yl]oxy]ethyl acetate (PubChem CID 42610648) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-[[(4R,5S,16R,18S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-22-oxo-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-18-yl]oxy]ethyl acetate.
| Compound Name | 2-[[(4R,5S,16R,18S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-22-oxo-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-18-yl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 42610648 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[[(4R,5S,16R,18S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-22-oxo-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-18-yl]oxy]ethyl acetate |
| SMILES | CC(=O)OCCO[C@H]1C[C@H]2Cc3c([nH]c4ccccc34)[C@]2(C)[C@@]2(C)CCC34O[C@@H](C(=O)C=C3[C@]12O)C(C)(C)O4 |
| InChI | InChI=1S/C31H37NO7/c1-17(33)36-12-13-37-24-15-18-14-20-19-8-6-7-9-21(19)32-25(20)29(18,5)28(4)10-11-30-23(31(24,28)35)16-22(34)26(38-30)27(2,3)39-30/h6-9,16,18,24,26,32,35H,10-15H2,1-5H3/t18-,24+,26+,28-,29-,30?,31+/m1/s1 |
| InChIKey | XUGQNHCUPMUTCK-UUQWGECOSA-N |
| XLogP | 3.88 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|