C27H35N5O4 — CID 42610739
N-[6-[(2R,6S)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-5-cyano-1H-imidazole-2-carboxamide (PubChem CID 42610739) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[6-[(2R,6S)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-5-cyano-1H-imidazole-2-carboxamide.
| Compound Name | N-[6-[(2R,6S)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-5-cyano-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 42610739 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[6-[(2R,6S)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-5-cyano-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3C[C@](C)(CO)O[C@](C)(CO)C3)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C27H35N5O4/c1-25(2)9-7-17(8-10-25)22-21(32-24(35)23-29-14-19(13-28)30-23)6-5-20(31-22)18-11-26(3,15-33)36-27(4,12-18)16-34/h5-7,14,18,33-34H,8-12,15-16H2,1-4H3,(H,29,30)(H,32,35)/t18?,26-,27+ |
| InChIKey | NTLVDAAELKUKKE-YZNDILABSA-N |
| XLogP | 3.92 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |