C28H36N4O3S — CID 42610809
5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1,1-dioxothian-4-yl)phenyl]-1H-imidazole-2-carboxamide (PubChem CID 42610809) has the molecular formula C28H36N4O3S and a molecular weight of 508.69 g/mol. Its IUPAC name is 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1,1-dioxothian-4-yl)phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1,1-dioxothian-4-yl)phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 42610809 |
| Molecular Formula | C28H36N4O3S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1,1-dioxothian-4-yl)phenyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2cc(C3CC(C)(C)S(=O)(=O)C(C)(C)C3)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C28H36N4O3S/c1-26(2)11-9-18(10-12-26)22-13-19(20-14-27(3,4)36(34,35)28(5,6)15-20)7-8-23(22)32-25(33)24-30-17-21(16-29)31-24/h7-9,13,17,20H,10-12,14-15H2,1-6H3,(H,30,31)(H,32,33) |
| InChIKey | IJHJSHFKVNEYSN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |