About 2,2,5,5-tetraethoxyhexane
2,2,5,5-tetraethoxyhexane (PubChem CID 42611383) has the molecular formula C14H30O4
and a molecular weight of 262.39 g/mol. Its IUPAC name is 2,2,5,5-tetraethoxyhexane.
Molecular Properties
| Compound Name | 2,2,5,5-tetraethoxyhexane |
| PubChem CID | 42611383 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 2,2,5,5-tetraethoxyhexane |
| SMILES | CCOC(C)(CCC(C)(OCC)OCC)OCC |
| InChI | InChI=1S/C14H30O4/c1-7-15-13(5,16-8-2)11-12-14(6,17-9-3)18-10-4/h7-12H2,1-6H3 |
| InChIKey | QTGBMIYEPGTHON-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,5,5-tetraethoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,5,5-tetraethoxyhexane?
The IUPAC name of 2,2,5,5-tetraethoxyhexane (CID 42611383) is 2,2,5,5-tetraethoxyhexane.
What is the SMILES notation for 2,2,5,5-tetraethoxyhexane?
The canonical SMILES for 2,2,5,5-tetraethoxyhexane is CCOC(C)(CCC(C)(OCC)OCC)OCC.
What is the InChIKey of 2,2,5,5-tetraethoxyhexane?
The InChIKey is QTGBMIYEPGTHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4/c1-7-15-13(5,16-8-2)11-12-14(6,17-9-3)18-10-4/h7-12H2,1-6H3.
What are the key properties of 2,2,5,5-tetraethoxyhexane?
2,2,5,5-tetraethoxyhexane has a molecular weight of 262.39 g/mol, XLogP of 3.35, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,5,5-tetraethoxyhexane is sourced from PubChem (CID 42611383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).