C28H26ClNO5S2 — CID 42611509
(7R,11S)-7-(4-chlorophenyl)-10-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione (PubChem CID 42611509) has the molecular formula C28H26ClNO5S2 and a molecular weight of 556.11 g/mol. Its IUPAC name is (7R,11S)-7-(4-chlorophenyl)-10-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione.
| Compound Name | (7R,11S)-7-(4-chlorophenyl)-10-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 42611509 |
| Molecular Formula | C28H26ClNO5S2 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | (7R,11S)-7-(4-chlorophenyl)-10-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)CC(=O)C2(C(=O)C1)[C@@H](c1ccc(Cl)cc1)CC(=O)C(=C1SCCS1)[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H26ClNO5S2/c1-27(2)14-22(32)28(23(33)15-27)20(16-3-7-18(29)8-4-16)13-21(31)24(26-36-11-12-37-26)25(28)17-5-9-19(10-6-17)30(34)35/h3-10,20,25H,11-15H2,1-2H3/t20-,25-/m1/s1 |
| InChIKey | TXHYTMPEIIXACO-CJFMBICVSA-N |
| XLogP | 6.72 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|