C17H25NO6 — CID 42611523
[(2R,3R,5S,6S)-4,5-diacetyloxy-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate (PubChem CID 42611523) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-4,5-diacetyloxy-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate.
| Compound Name | [(2R,3R,5S,6S)-4,5-diacetyloxy-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 42611523 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [(2R,3R,5S,6S)-4,5-diacetyloxy-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate |
| SMILES | C=CC[C@@H]1N[C@H](CC=C)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H25NO6/c1-6-8-13-15(22-10(3)19)17(24-12(5)21)16(23-11(4)20)14(18-13)9-7-2/h6-7,13-18H,1-2,8-9H2,3-5H3/t13-,14+,15-,16+,17? |
| InChIKey | LXTMMVXDXCYHAQ-SJJOOFSGSA-N |
| XLogP | 1.27 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|