C24H31NO6 — CID 42611729
[(3S,5R)-4,5-diacetyloxy-1-benzyl-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate (PubChem CID 42611729) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is [(3S,5R)-4,5-diacetyloxy-1-benzyl-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate.
| Compound Name | [(3S,5R)-4,5-diacetyloxy-1-benzyl-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 42611729 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [(3S,5R)-4,5-diacetyloxy-1-benzyl-2,6-bis(prop-2-enyl)piperidin-3-yl] acetate |
| SMILES | C=CCC1[C@H](OC(C)=O)C(OC(C)=O)[C@H](OC(C)=O)C(CC=C)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO6/c1-6-11-20-22(29-16(3)26)24(31-18(5)28)23(30-17(4)27)21(12-7-2)25(20)15-19-13-9-8-10-14-19/h6-10,13-14,20-24H,1-2,11-12,15H2,3-5H3/t20?,21?,22-,23+,24? |
| InChIKey | HHTIXMFREDQXQU-BSZVUXMWSA-N |
| XLogP | 3.19 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|